About 1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane
1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane (PubChem CID 56823381) has the molecular formula C15H22N6
and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane |
| PubChem CID | 56823381 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane |
| SMILES | Cc1cc(C)n(-c2cncc(N3CCCN(C)CC3)n2)n1 |
| InChI | InChI=1S/C15H22N6/c1-12-9-13(2)21(18-12)15-11-16-10-14(17-15)20-6-4-5-19(3)7-8-20/h9-11H,4-8H2,1-3H3 |
| InChIKey | MRWJIQDPJOMFKC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane?
The IUPAC name of 1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane (CID 56823381) is 1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane.
What is the SMILES notation for 1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane?
The canonical SMILES for 1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane is Cc1cc(C)n(-c2cncc(N3CCCN(C)CC3)n2)n1.
What is the InChIKey of 1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane?
The InChIKey is MRWJIQDPJOMFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N6/c1-12-9-13(2)21(18-12)15-11-16-10-14(17-15)20-6-4-5-19(3)7-8-20/h9-11H,4-8H2,1-3H3.
What are the key properties of 1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane?
1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane has a molecular weight of 286.38 g/mol, XLogP of 1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-4-methyl-1,4-diazepane is sourced from PubChem (CID 56823381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).