C16H21N5O2 — CID 56823440
3-(furan-2-ylmethylamino)-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one (PubChem CID 56823440) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 3-(furan-2-ylmethylamino)-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-(furan-2-ylmethylamino)-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 56823440 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 3-(furan-2-ylmethylamino)-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
| SMILES | O=C(CCNCc1ccco1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H21N5O2/c22-15(4-7-17-13-14-3-1-12-23-14)20-8-10-21(11-9-20)16-18-5-2-6-19-16/h1-3,5-6,12,17H,4,7-11,13H2 |
| InChIKey | RGGICDMLVKZUSD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|