C18H20N6O — CID 56823906
N-(1-methylindol-4-yl)-4-pyrazin-2-ylpiperazine-1-carboxamide (PubChem CID 56823906) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is N-(1-methylindol-4-yl)-4-pyrazin-2-ylpiperazine-1-carboxamide.
| Compound Name | N-(1-methylindol-4-yl)-4-pyrazin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 56823906 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-(1-methylindol-4-yl)-4-pyrazin-2-ylpiperazine-1-carboxamide |
| SMILES | Cn1ccc2c(NC(=O)N3CCN(c4cnccn4)CC3)cccc21 |
| InChI | InChI=1S/C18H20N6O/c1-22-8-5-14-15(3-2-4-16(14)22)21-18(25)24-11-9-23(10-12-24)17-13-19-6-7-20-17/h2-8,13H,9-12H2,1H3,(H,21,25) |
| InChIKey | AVTHDAGVNPEBJF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |