About N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide
N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide (PubChem CID 56823980) has the molecular formula C16H20FN3OS
and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide |
| PubChem CID | 56823980 |
| Molecular Formula | C16H20FN3OS |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cnc(Cc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C16H20FN3OS/c1-20(2)9-3-8-18-16(21)14-11-19-15(22-14)10-12-4-6-13(17)7-5-12/h4-7,11H,3,8-10H2,1-2H3,(H,18,21) |
| InChIKey | NJJAKZOBGVLJDD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide?
The IUPAC name of N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide (CID 56823980) is N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide is CN(C)CCCNC(=O)c1cnc(Cc2ccc(F)cc2)s1.
What is the InChIKey of N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide?
The InChIKey is NJJAKZOBGVLJDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20FN3OS/c1-20(2)9-3-8-18-16(21)14-11-19-15(22-14)10-12-4-6-13(17)7-5-12/h4-7,11H,3,8-10H2,1-2H3,(H,18,21).
What are the key properties of N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide?
N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide has a molecular weight of 321.42 g/mol, XLogP of 2.55, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(dimethylamino)propyl]-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 56823980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).