About 3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide
3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide (PubChem CID 56824140) has the molecular formula C16H18F2N2O2S
and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide |
| PubChem CID | 56824140 |
| Molecular Formula | C16H18F2N2O2S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(C(C)NCc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C16H18F2N2O2S/c1-11(20-10-13-6-7-14(17)9-16(13)18)12-4-3-5-15(8-12)23(21,22)19-2/h3-9,11,19-20H,10H2,1-2H3 |
| InChIKey | ISLQHYXWDVRINW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide?
The IUPAC name of 3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide (CID 56824140) is 3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide.
What is the SMILES notation for 3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide?
The canonical SMILES for 3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide is CNS(=O)(=O)c1cccc(C(C)NCc2ccc(F)cc2F)c1.
What is the InChIKey of 3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide?
The InChIKey is ISLQHYXWDVRINW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F2N2O2S/c1-11(20-10-13-6-7-14(17)9-16(13)18)12-4-3-5-15(8-12)23(21,22)19-2/h3-9,11,19-20H,10H2,1-2H3.
What are the key properties of 3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide?
3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide has a molecular weight of 340.40 g/mol, XLogP of 2.72, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[(2,4-difluorophenyl)methylamino]ethyl]-N-methylbenzenesulfonamide is sourced from PubChem (CID 56824140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).