C13H26N2 — CID 56824391
N,N-dimethyl-1-[1-(3-methylbut-2-enyl)piperidin-4-yl]methanamine (PubChem CID 56824391) has the molecular formula C13H26N2 and a molecular weight of 210.37 g/mol. Its IUPAC name is N,N-dimethyl-1-[1-(3-methylbut-2-enyl)piperidin-4-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[1-(3-methylbut-2-enyl)piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 56824391 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | N,N-dimethyl-1-[1-(3-methylbut-2-enyl)piperidin-4-yl]methanamine |
| SMILES | CC(C)=CCN1CCC(CN(C)C)CC1 |
| InChI | InChI=1S/C13H26N2/c1-12(2)5-8-15-9-6-13(7-10-15)11-14(3)4/h5,13H,6-11H2,1-4H3 |
| InChIKey | VPZGHBYWWGOAGA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|