About N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide
N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide (PubChem CID 56824439) has the molecular formula C14H17F3N2O2S
and a molecular weight of 334.36 g/mol. Its IUPAC name is N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide.
Molecular Properties
| Compound Name | N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide |
| PubChem CID | 56824439 |
| Molecular Formula | C14H17F3N2O2S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide |
| SMILES | Cc1c(NC(=O)N2CCSCC2)cccc1OCC(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O2S/c1-10-11(18-13(20)19-5-7-22-8-6-19)3-2-4-12(10)21-9-14(15,16)17/h2-4H,5-9H2,1H3,(H,18,20) |
| InChIKey | VTFQHALNTUXWMR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide?
The IUPAC name of N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide (CID 56824439) is N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide.
What is the SMILES notation for N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide?
The canonical SMILES for N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide is Cc1c(NC(=O)N2CCSCC2)cccc1OCC(F)(F)F.
What is the InChIKey of N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide?
The InChIKey is VTFQHALNTUXWMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F3N2O2S/c1-10-11(18-13(20)19-5-7-22-8-6-19)3-2-4-12(10)21-9-14(15,16)17/h2-4H,5-9H2,1H3,(H,18,20).
What are the key properties of N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide?
N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide has a molecular weight of 334.36 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-methyl-3-(2,2,2-trifluoroethoxy)phenyl]thiomorpholine-4-carboxamide is sourced from PubChem (CID 56824439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).