C13H14BrN3O2 — CID 56824993
(5-bromofuran-3-yl)-[2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methanone (PubChem CID 56824993) has the molecular formula C13H14BrN3O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is (5-bromofuran-3-yl)-[2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (5-bromofuran-3-yl)-[2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 56824993 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | (5-bromofuran-3-yl)-[2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methanone |
| SMILES | Cn1cc(C2CCCN2C(=O)c2coc(Br)c2)cn1 |
| InChI | InChI=1S/C13H14BrN3O2/c1-16-7-10(6-15-16)11-3-2-4-17(11)13(18)9-5-12(14)19-8-9/h5-8,11H,2-4H2,1H3 |
| InChIKey | DPAABBAREIHRRC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |