C17H19F2N5O — CID 56825447
1-cyclopropyl-1-[(2,4-difluorophenyl)methyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea (PubChem CID 56825447) has the molecular formula C17H19F2N5O and a molecular weight of 347.37 g/mol. Its IUPAC name is 1-cyclopropyl-1-[(2,4-difluorophenyl)methyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea.
| Compound Name | 1-cyclopropyl-1-[(2,4-difluorophenyl)methyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea |
|---|---|
| PubChem CID | 56825447 |
| Molecular Formula | C17H19F2N5O |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1-cyclopropyl-1-[(2,4-difluorophenyl)methyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea |
| SMILES | O=C(NCCNc1ncccn1)N(Cc1ccc(F)cc1F)C1CC1 |
| InChI | InChI=1S/C17H19F2N5O/c18-13-3-2-12(15(19)10-13)11-24(14-4-5-14)17(25)23-9-8-22-16-20-6-1-7-21-16/h1-3,6-7,10,14H,4-5,8-9,11H2,(H,23,25)(H,20,21,22) |
| InChIKey | XNRUJYDLLJCHPD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|