C15H21N7O2 — CID 56826141
4-(4-methoxypyrimidin-2-yl)-N-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carboxamide (PubChem CID 56826141) has the molecular formula C15H21N7O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-(4-methoxypyrimidin-2-yl)-N-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-methoxypyrimidin-2-yl)-N-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 56826141 |
| Molecular Formula | C15H21N7O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4-(4-methoxypyrimidin-2-yl)-N-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carboxamide |
| SMILES | COc1ccnc(N2CCN(C(=O)NCc3cnn(C)c3)CC2)n1 |
| InChI | InChI=1S/C15H21N7O2/c1-20-11-12(10-18-20)9-17-15(23)22-7-5-21(6-8-22)14-16-4-3-13(19-14)24-2/h3-4,10-11H,5-9H2,1-2H3,(H,17,23) |
| InChIKey | NDLGXSYPTOYHCJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |