About 4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole
4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole (PubChem CID 56826224) has the molecular formula C10H10ClN3OS
and a molecular weight of 255.73 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole.
Molecular Properties
| Compound Name | 4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole |
| PubChem CID | 56826224 |
| Molecular Formula | C10H10ClN3OS |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole |
| SMILES | CS(=O)c1nncn1Cc1ccccc1Cl |
| InChI | InChI=1S/C10H10ClN3OS/c1-16(15)10-13-12-7-14(10)6-8-4-2-3-5-9(8)11/h2-5,7H,6H2,1H3 |
| InChIKey | BYQIDBOUTNKYCY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole?
The IUPAC name of 4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole (CID 56826224) is 4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole.
What is the SMILES notation for 4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole?
The canonical SMILES for 4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole is CS(=O)c1nncn1Cc1ccccc1Cl.
What is the InChIKey of 4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole?
The InChIKey is BYQIDBOUTNKYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3OS/c1-16(15)10-13-12-7-14(10)6-8-4-2-3-5-9(8)11/h2-5,7H,6H2,1H3.
What are the key properties of 4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole?
4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole has a molecular weight of 255.73 g/mol, XLogP of 1.72, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-chlorophenyl)methyl]-3-methylsulfinyl-1,2,4-triazole is sourced from PubChem (CID 56826224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).