C16H19ClN2O3 — CID 56826665
2-(5-chloro-3-methyl-1,2-oxazol-4-yl)-N-[3-(2-methylphenoxy)propyl]acetamide (PubChem CID 56826665) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is 2-(5-chloro-3-methyl-1,2-oxazol-4-yl)-N-[3-(2-methylphenoxy)propyl]acetamide.
| Compound Name | 2-(5-chloro-3-methyl-1,2-oxazol-4-yl)-N-[3-(2-methylphenoxy)propyl]acetamide |
|---|---|
| PubChem CID | 56826665 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-(5-chloro-3-methyl-1,2-oxazol-4-yl)-N-[3-(2-methylphenoxy)propyl]acetamide |
| SMILES | Cc1ccccc1OCCCNC(=O)Cc1c(C)noc1Cl |
| InChI | InChI=1S/C16H19ClN2O3/c1-11-6-3-4-7-14(11)21-9-5-8-18-15(20)10-13-12(2)19-22-16(13)17/h3-4,6-7H,5,8-10H2,1-2H3,(H,18,20) |
| InChIKey | HRZRSIAGOMHNDB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|