About N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide
N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide (PubChem CID 56826928) has the molecular formula C20H18N4O2
and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide |
| PubChem CID | 56826928 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide |
| SMILES | CN1C(=O)CCc2cc(NC(=O)c3cn[nH]c3-c3ccccc3)ccc21 |
| InChI | InChI=1S/C20H18N4O2/c1-24-17-9-8-15(11-14(17)7-10-18(24)25)22-20(26)16-12-21-23-19(16)13-5-3-2-4-6-13/h2-6,8-9,11-12H,7,10H2,1H3,(H,21,23)(H,22,26) |
| InChIKey | ZGFASPLRNZTWJC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide?
The IUPAC name of N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide (CID 56826928) is N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide.
What is the SMILES notation for N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide?
The canonical SMILES for N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide is CN1C(=O)CCc2cc(NC(=O)c3cn[nH]c3-c3ccccc3)ccc21.
What is the InChIKey of N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide?
The InChIKey is ZGFASPLRNZTWJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O2/c1-24-17-9-8-15(11-14(17)7-10-18(24)25)22-20(26)16-12-21-23-19(16)13-5-3-2-4-6-13/h2-6,8-9,11-12H,7,10H2,1H3,(H,21,23)(H,22,26).
What are the key properties of N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide?
N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide has a molecular weight of 346.39 g/mol, XLogP of 3.24, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5-phenyl-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 56826928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).