C13H18ClNO3S2 — CID 56827237
N-(5-chloro-2-propan-2-ylsulfanylphenyl)-3-methylsulfonylpropanamide (PubChem CID 56827237) has the molecular formula C13H18ClNO3S2 and a molecular weight of 335.88 g/mol. Its IUPAC name is N-(5-chloro-2-propan-2-ylsulfanylphenyl)-3-methylsulfonylpropanamide.
| Compound Name | N-(5-chloro-2-propan-2-ylsulfanylphenyl)-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 56827237 |
| Molecular Formula | C13H18ClNO3S2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | N-(5-chloro-2-propan-2-ylsulfanylphenyl)-3-methylsulfonylpropanamide |
| SMILES | CC(C)Sc1ccc(Cl)cc1NC(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C13H18ClNO3S2/c1-9(2)19-12-5-4-10(14)8-11(12)15-13(16)6-7-20(3,17)18/h4-5,8-9H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | KGNUCJIKTDDOEE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |