About N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine
N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine (PubChem CID 56828625) has the molecular formula C5H10N4
and a molecular weight of 126.16 g/mol. Its IUPAC name is N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine |
| PubChem CID | 56828625 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine |
| SMILES | CNCc1ncnn1C |
| InChI | InChI=1S/C5H10N4/c1-6-3-5-7-4-8-9(5)2/h4,6H,3H2,1-2H3 |
| InChIKey | XFRKAZBZVVTALF-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine?
The IUPAC name of N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine (CID 56828625) is N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine.
What is the SMILES notation for N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine?
The canonical SMILES for N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine is CNCc1ncnn1C.
What is the InChIKey of N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine?
The InChIKey is XFRKAZBZVVTALF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4/c1-6-3-5-7-4-8-9(5)2/h4,6H,3H2,1-2H3.
What are the key properties of N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine?
N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine has a molecular weight of 126.16 g/mol, XLogP of -0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)methanamine is sourced from PubChem (CID 56828625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).