4,4-dimethylpiperidine-1-sulfonyl chloride

C7H14ClNO2S — CID 56828646

IUPAC4,4-dimethylpiperidine-1-sulfonyl chloride
SMILESCC1(C)CCN(S(=O)(=O)Cl)CC1
InChIInChI=1S/C7H14ClNO2S/c1-7(2)3-5-9(6-4-7)12(8,10)11/h3-6H2,1-2H3
InChIKeyBZBQADRBYSOTOA-UHFFFAOYSA-N
MW211.71 g/mol
LogP1.59
Rot. Bonds1

About 4,4-dimethylpiperidine-1-sulfonyl chloride

4,4-dimethylpiperidine-1-sulfonyl chloride (PubChem CID 56828646) has the molecular formula C7H14ClNO2S and a molecular weight of 211.71 g/mol. Its IUPAC name is 4,4-dimethylpiperidine-1-sulfonyl chloride.

Molecular Properties

Compound Name4,4-dimethylpiperidine-1-sulfonyl chloride
PubChem CID56828646
Molecular FormulaC7H14ClNO2S
Molecular Weight211.71 g/mol
Exact Mass211.04
IUPAC Name4,4-dimethylpiperidine-1-sulfonyl chloride
SMILESCC1(C)CCN(S(=O)(=O)Cl)CC1
InChIInChI=1S/C7H14ClNO2S/c1-7(2)3-5-9(6-4-7)12(8,10)11/h3-6H2,1-2H3
InChIKeyBZBQADRBYSOTOA-UHFFFAOYSA-N
XLogP1.59
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.71
LogP ≤ 51.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 4,4-dimethylpiperidine-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-dimethylpiperidine-1-sulfonyl chloride?
The IUPAC name of 4,4-dimethylpiperidine-1-sulfonyl chloride (CID 56828646) is 4,4-dimethylpiperidine-1-sulfonyl chloride.
What is the SMILES notation for 4,4-dimethylpiperidine-1-sulfonyl chloride?
The canonical SMILES for 4,4-dimethylpiperidine-1-sulfonyl chloride is CC1(C)CCN(S(=O)(=O)Cl)CC1.
What is the InChIKey of 4,4-dimethylpiperidine-1-sulfonyl chloride?
The InChIKey is BZBQADRBYSOTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14ClNO2S/c1-7(2)3-5-9(6-4-7)12(8,10)11/h3-6H2,1-2H3.
What are the key properties of 4,4-dimethylpiperidine-1-sulfonyl chloride?
4,4-dimethylpiperidine-1-sulfonyl chloride has a molecular weight of 211.71 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethylpiperidine-1-sulfonyl chloride is sourced from PubChem (CID 56828646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).