C10H12BrN3S — CID 56828835
N-[(5-bromothiophen-3-yl)methyl]-2-pyrazol-1-ylethanamine (PubChem CID 56828835) has the molecular formula C10H12BrN3S and a molecular weight of 286.20 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-2-pyrazol-1-ylethanamine.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-2-pyrazol-1-ylethanamine |
|---|---|
| PubChem CID | 56828835 |
| Molecular Formula | C10H12BrN3S |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-2-pyrazol-1-ylethanamine |
| SMILES | Brc1cc(CNCCn2cccn2)cs1 |
| InChI | InChI=1S/C10H12BrN3S/c11-10-6-9(8-15-10)7-12-3-5-14-4-1-2-13-14/h1-2,4,6,8,12H,3,5,7H2 |
| InChIKey | AGIJFEYVHUMVMW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|