C13H15F2N3O — CID 56828863
1-(3,4-difluorophenyl)-2-(2-pyrazol-1-ylethylamino)ethanol (PubChem CID 56828863) has the molecular formula C13H15F2N3O and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-(2-pyrazol-1-ylethylamino)ethanol.
| Compound Name | 1-(3,4-difluorophenyl)-2-(2-pyrazol-1-ylethylamino)ethanol |
|---|---|
| PubChem CID | 56828863 |
| Molecular Formula | C13H15F2N3O |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-(2-pyrazol-1-ylethylamino)ethanol |
| SMILES | OC(CNCCn1cccn1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H15F2N3O/c14-11-3-2-10(8-12(11)15)13(19)9-16-5-7-18-6-1-4-17-18/h1-4,6,8,13,16,19H,5,7,9H2 |
| InChIKey | NXXHCEQUQWOHEQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|