About piperidin-3-ylmethyl cyclopropanecarboxylate
piperidin-3-ylmethyl cyclopropanecarboxylate (PubChem CID 56829549) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is piperidin-3-ylmethyl cyclopropanecarboxylate.
Molecular Properties
| Compound Name | piperidin-3-ylmethyl cyclopropanecarboxylate |
| PubChem CID | 56829549 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | piperidin-3-ylmethyl cyclopropanecarboxylate |
| SMILES | O=C(OCC1CCCNC1)C1CC1 |
| InChI | InChI=1S/C10H17NO2/c12-10(9-3-4-9)13-7-8-2-1-5-11-6-8/h8-9,11H,1-7H2 |
| InChIKey | LVESGAFALXIVIV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-3-ylmethyl cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-3-ylmethyl cyclopropanecarboxylate?
The IUPAC name of piperidin-3-ylmethyl cyclopropanecarboxylate (CID 56829549) is piperidin-3-ylmethyl cyclopropanecarboxylate.
What is the SMILES notation for piperidin-3-ylmethyl cyclopropanecarboxylate?
The canonical SMILES for piperidin-3-ylmethyl cyclopropanecarboxylate is O=C(OCC1CCCNC1)C1CC1.
What is the InChIKey of piperidin-3-ylmethyl cyclopropanecarboxylate?
The InChIKey is LVESGAFALXIVIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c12-10(9-3-4-9)13-7-8-2-1-5-11-6-8/h8-9,11H,1-7H2.
What are the key properties of piperidin-3-ylmethyl cyclopropanecarboxylate?
piperidin-3-ylmethyl cyclopropanecarboxylate has a molecular weight of 183.25 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-3-ylmethyl cyclopropanecarboxylate is sourced from PubChem (CID 56829549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).