C19H18O4 — CID 5683
CID 5683 (PubChem CID 5683) has the molecular formula C19H18O4 and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-hydroxy-3-(3-hydroxy-1-phenylbutyl)chromen-4-one.
| Compound Name | CID 5683 |
|---|---|
| PubChem CID | 5683 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-hydroxy-3-(3-hydroxy-1-phenylbutyl)chromen-4-one |
| SMILES | CC(CC(C1=CC=CC=C1)C2=C(OC3=CC=CC=C3C2=O)O)O |
| InChIKey | ITRHMRDQFXQTDH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 464 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |