C17H16F6N2O3S2 — CID 56832521
1,1,1,3,3,3-hexafluoro-2-[4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)phenyl]propan-2-ol (PubChem CID 56832521) has the molecular formula C17H16F6N2O3S2 and a molecular weight of 474.45 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 56832521 |
| Molecular Formula | C17H16F6N2O3S2 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)phenyl]propan-2-ol |
| SMILES | O=S(=O)(c1cccs1)N1CCN(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H16F6N2O3S2/c18-16(19,20)15(26,17(21,22)23)12-3-5-13(6-4-12)24-7-9-25(10-8-24)30(27,28)14-2-1-11-29-14/h1-6,11,26H,7-10H2 |
| InChIKey | FTXKDYBMOPKENQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|