C37H48O3Si — CID 56833323
tert-butyl-[3-[(2R,3S,6R,8S)-3-methyl-8-[(E)-2-phenylethenyl]-1,7-dioxaspiro[5.5]undecan-2-yl]propoxy]-diphenylsilane (PubChem CID 56833323) has the molecular formula C37H48O3Si and a molecular weight of 568.87 g/mol. Its IUPAC name is tert-butyl-[3-[(2R,3S,6R,8S)-3-methyl-8-[(E)-2-phenylethenyl]-1,7-dioxaspiro[5.5]undecan-2-yl]propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[3-[(2R,3S,6R,8S)-3-methyl-8-[(E)-2-phenylethenyl]-1,7-dioxaspiro[5.5]undecan-2-yl]propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 56833323 |
| Molecular Formula | C37H48O3Si |
| Molecular Weight | 568.87 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | tert-butyl-[3-[(2R,3S,6R,8S)-3-methyl-8-[(E)-2-phenylethenyl]-1,7-dioxaspiro[5.5]undecan-2-yl]propoxy]-diphenylsilane |
| SMILES | C[C@H]1CC[C@]2(CCC[C@@H](/C=C/c3ccccc3)O2)O[C@@H]1CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C37H48O3Si/c1-30-26-28-37(27-14-18-32(39-37)25-24-31-16-8-5-9-17-31)40-35(30)23-15-29-38-41(36(2,3)4,33-19-10-6-11-20-33)34-21-12-7-13-22-34/h5-13,16-17,19-22,24-25,30,32,35H,14-15,18,23,26-29H2,1-4H3/b25-24+/t30-,32-,35+,37-/m0/s1 |
| InChIKey | OYLCZNNKHGMZBE-UQJJIQERSA-N |
| XLogP | 8.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.87 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|