C25H45N3O3SSi2 — CID 56833678
[(2R,3R,4R,5R)-3-azido-5-[diethyl(propan-2-yl)silyl]oxy-2-phenylsulfanyloxan-4-yl]oxy-diethyl-propan-2-ylsilane (PubChem CID 56833678) has the molecular formula C25H45N3O3SSi2 and a molecular weight of 523.89 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3-azido-5-[diethyl(propan-2-yl)silyl]oxy-2-phenylsulfanyloxan-4-yl]oxy-diethyl-propan-2-ylsilane.
| Compound Name | [(2R,3R,4R,5R)-3-azido-5-[diethyl(propan-2-yl)silyl]oxy-2-phenylsulfanyloxan-4-yl]oxy-diethyl-propan-2-ylsilane |
|---|---|
| PubChem CID | 56833678 |
| Molecular Formula | C25H45N3O3SSi2 |
| Molecular Weight | 523.89 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | [(2R,3R,4R,5R)-3-azido-5-[diethyl(propan-2-yl)silyl]oxy-2-phenylsulfanyloxan-4-yl]oxy-diethyl-propan-2-ylsilane |
| SMILES | CC[Si](CC)(O[C@@H]1[C@@H](N=[N+]=[N-])[C@@H](Sc2ccccc2)OC[C@H]1O[Si](CC)(CC)C(C)C)C(C)C |
| InChI | InChI=1S/C25H45N3O3SSi2/c1-9-33(10-2,19(5)6)30-22-18-29-25(32-21-16-14-13-15-17-21)23(27-28-26)24(22)31-34(11-3,12-4)20(7)8/h13-17,19-20,22-25H,9-12,18H2,1-8H3/t22-,23-,24+,25-/m1/s1 |
| InChIKey | QFNVOODITUEXKR-ZKGSSEMHSA-N |
| XLogP | 8.37 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.89 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|