C15H18Cl3NO5S — CID 56833680
2,2,2-trichloroethyl N-[(2R,3R,4R,5R)-4,5-dihydroxy-2-phenylsulfanyloxan-3-yl]-N-methylcarbamate (PubChem CID 56833680) has the molecular formula C15H18Cl3NO5S and a molecular weight of 430.74 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(2R,3R,4R,5R)-4,5-dihydroxy-2-phenylsulfanyloxan-3-yl]-N-methylcarbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(2R,3R,4R,5R)-4,5-dihydroxy-2-phenylsulfanyloxan-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 56833680 |
| Molecular Formula | C15H18Cl3NO5S |
| Molecular Weight | 430.74 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(2R,3R,4R,5R)-4,5-dihydroxy-2-phenylsulfanyloxan-3-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCC(Cl)(Cl)Cl)[C@@H]1[C@@H](O)[C@H](O)CO[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C15H18Cl3NO5S/c1-19(14(22)24-8-15(16,17)18)11-12(21)10(20)7-23-13(11)25-9-5-3-2-4-6-9/h2-6,10-13,20-21H,7-8H2,1H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | NJXPPWBUICEAHZ-FVCCEPFGSA-N |
| XLogP | 2.66 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.74 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|