C21H17BrClNO2S — CID 56834152
8-(bromomethyl)-N-(2-chlorophenyl)-N-methyl-4,5-dihydrothieno[3,2-d][1]benzoxepine-2-carboxamide (PubChem CID 56834152) has the molecular formula C21H17BrClNO2S and a molecular weight of 462.80 g/mol. Its IUPAC name is 8-(bromomethyl)-N-(2-chlorophenyl)-N-methyl-4,5-dihydrothieno[3,2-d][1]benzoxepine-2-carboxamide.
| Compound Name | 8-(bromomethyl)-N-(2-chlorophenyl)-N-methyl-4,5-dihydrothieno[3,2-d][1]benzoxepine-2-carboxamide |
|---|---|
| PubChem CID | 56834152 |
| Molecular Formula | C21H17BrClNO2S |
| Molecular Weight | 462.80 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | 8-(bromomethyl)-N-(2-chlorophenyl)-N-methyl-4,5-dihydrothieno[3,2-d][1]benzoxepine-2-carboxamide |
| SMILES | CN(C(=O)c1cc2c(s1)-c1ccc(CBr)cc1OCC2)c1ccccc1Cl |
| InChI | InChI=1S/C21H17BrClNO2S/c1-24(17-5-3-2-4-16(17)23)21(25)19-11-14-8-9-26-18-10-13(12-22)6-7-15(18)20(14)27-19/h2-7,10-11H,8-9,12H2,1H3 |
| InChIKey | LTZDKRFZBMXJOS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.80 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|