C27H31N2+ — CID 56834307
(4S)-4-phenyl-1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium (PubChem CID 56834307) has the molecular formula C27H31N2+ and a molecular weight of 383.56 g/mol. Its IUPAC name is (4S)-4-phenyl-1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium.
| Compound Name | (4S)-4-phenyl-1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 56834307 |
| Molecular Formula | C27H31N2+ |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | (4S)-4-phenyl-1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium |
| SMILES | Cc1cc(C)c(N2C=[N+](c3c(C)cc(C)cc3C)C[C@@H]2c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C27H31N2/c1-18-12-20(3)26(21(4)13-18)28-16-25(24-10-8-7-9-11-24)29(17-28)27-22(5)14-19(2)15-23(27)6/h7-15,17,25H,16H2,1-6H3/q+1/t25-/m1/s1 |
| InChIKey | TWEAQSYNKPNXGC-RUZDIDTESA-N |
| XLogP | 6.47 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|