C25H24O2 — CID 56834337
(2R,3S)-2-benzyl-3-(4-methoxyphenyl)-5-phenylpent-4-yn-1-ol (PubChem CID 56834337) has the molecular formula C25H24O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2R,3S)-2-benzyl-3-(4-methoxyphenyl)-5-phenylpent-4-yn-1-ol.
| Compound Name | (2R,3S)-2-benzyl-3-(4-methoxyphenyl)-5-phenylpent-4-yn-1-ol |
|---|---|
| PubChem CID | 56834337 |
| Molecular Formula | C25H24O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (2R,3S)-2-benzyl-3-(4-methoxyphenyl)-5-phenylpent-4-yn-1-ol |
| SMILES | COc1ccc([C@@H](C#Cc2ccccc2)[C@H](CO)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H24O2/c1-27-24-15-13-22(14-16-24)25(17-12-20-8-4-2-5-9-20)23(19-26)18-21-10-6-3-7-11-21/h2-11,13-16,23,25-26H,18-19H2,1H3/t23-,25+/m0/s1 |
| InChIKey | ABKBFGJKAJIING-UKILVPOCSA-N |
| XLogP | 4.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|