C14H18N2O5 — CID 56834467
(2S)-2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]-4-methylpentanoic acid (PubChem CID 56834467) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is (2S)-2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 56834467 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (2S)-2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]-4-methylpentanoic acid |
| SMILES | CC(=O)NC1=CC(=O)C(N[C@@H](CC(C)C)C(=O)O)=CC1=O |
| InChI | InChI=1S/C14H18N2O5/c1-7(2)4-11(14(20)21)16-10-6-12(18)9(5-13(10)19)15-8(3)17/h5-7,11,16H,4H2,1-3H3,(H,15,17)(H,20,21)/t11-/m0/s1 |
| InChIKey | CXNQOKVLMZBVSF-NSHDSACASA-N |
| XLogP | 0.13 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|