C30H44O6 — CID 56834469
(3E,5E,7E,11E,17Z,19E)-22-[(E)-but-1-enyl]-14,15-dihydroxy-10,16-dimethoxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one (PubChem CID 56834469) has the molecular formula C30H44O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is (3E,5E,7E,11E,17Z,19E)-22-[(E)-but-1-enyl]-14,15-dihydroxy-10,16-dimethoxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one.
| Compound Name | (3E,5E,7E,11E,17Z,19E)-22-[(E)-but-1-enyl]-14,15-dihydroxy-10,16-dimethoxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one |
|---|---|
| PubChem CID | 56834469 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | (3E,5E,7E,11E,17Z,19E)-22-[(E)-but-1-enyl]-14,15-dihydroxy-10,16-dimethoxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one |
| SMILES | CC/C=C/C1C/C=C/C=C\C(OC)C(O)C(O)C(C)/C=C/C(OC)C(C)/C=C/C=C(C)/C=C/C(=O)O1 |
| InChI | InChI=1S/C30H44O6/c1-7-8-15-25-16-10-9-11-17-27(35-6)30(33)29(32)24(4)19-20-26(34-5)23(3)14-12-13-22(2)18-21-28(31)36-25/h8-15,17-21,23-27,29-30,32-33H,7,16H2,1-6H3/b10-9+,14-12+,15-8+,17-11-,20-19+,21-18+,22-13+ |
| InChIKey | OGIODIOJAWTXMG-IPSJHBJRSA-N |
| XLogP | 5.02 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|