C29H42O4 — CID 56834471
(3E,5E,7E,11E,17Z,19E)-22-[(E)-but-1-enyl]-14-hydroxy-16-methoxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one (PubChem CID 56834471) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is (3E,5E,7E,11E,17Z,19E)-22-[(E)-but-1-enyl]-14-hydroxy-16-methoxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one.
| Compound Name | (3E,5E,7E,11E,17Z,19E)-22-[(E)-but-1-enyl]-14-hydroxy-16-methoxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one |
|---|---|
| PubChem CID | 56834471 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | (3E,5E,7E,11E,17Z,19E)-22-[(E)-but-1-enyl]-14-hydroxy-16-methoxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one |
| SMILES | CC/C=C/C1C/C=C/C=C\C(OC)CC(O)C(C)/C=C/CC(C)/C=C/C=C(C)/C=C/C(=O)O1 |
| InChI | InChI=1S/C29H42O4/c1-6-7-17-26-18-9-8-10-19-27(32-5)22-28(30)25(4)16-12-15-23(2)13-11-14-24(3)20-21-29(31)33-26/h7-14,16-17,19-21,23,25-28,30H,6,15,18,22H2,1-5H3/b9-8+,13-11+,16-12+,17-7+,19-10-,21-20+,24-14+ |
| InChIKey | CKCNVLQCNLEZSB-VJKIWBRUSA-N |
| XLogP | 6.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|