C22H32O6 — CID 56834492
[(4S,5E,7S,10R,13R)-4,7-dihydroxy-7-methyl-11-methylidene-15-oxo-4-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),5-dien-10-yl] acetate (PubChem CID 56834492) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is [(4S,5E,7S,10R,13R)-4,7-dihydroxy-7-methyl-11-methylidene-15-oxo-4-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),5-dien-10-yl] acetate.
| Compound Name | [(4S,5E,7S,10R,13R)-4,7-dihydroxy-7-methyl-11-methylidene-15-oxo-4-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),5-dien-10-yl] acetate |
|---|---|
| PubChem CID | 56834492 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [(4S,5E,7S,10R,13R)-4,7-dihydroxy-7-methyl-11-methylidene-15-oxo-4-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),5-dien-10-yl] acetate |
| SMILES | C=C1C[C@@H]2C=C(CC[C@](O)(C(C)C)/C=C/[C@@](C)(O)CC[C@H]1OC(C)=O)C(=O)O2 |
| InChI | InChI=1S/C22H32O6/c1-14(2)22(26)9-6-17-13-18(28-20(17)24)12-15(3)19(27-16(4)23)7-8-21(5,25)10-11-22/h10-11,13-14,18-19,25-26H,3,6-9,12H2,1-2,4-5H3/b11-10+/t18-,19-,21+,22-/m1/s1 |
| InChIKey | RSJMCYXPPOHMKE-GWXVYRPJSA-N |
| XLogP | 2.98 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|