C29H52N2 — CID 56834630
N'-[[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-N,N'-bis(3-methylbut-2-enyl)butane-1,4-diamine (PubChem CID 56834630) has the molecular formula C29H52N2 and a molecular weight of 428.75 g/mol. Its IUPAC name is N'-[[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-N,N'-bis(3-methylbut-2-enyl)butane-1,4-diamine.
| Compound Name | N'-[[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-N,N'-bis(3-methylbut-2-enyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 56834630 |
| Molecular Formula | C29H52N2 |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.41 |
| IUPAC Name | N'-[[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-N,N'-bis(3-methylbut-2-enyl)butane-1,4-diamine |
| SMILES | CC(C)=CCNCCCCN(CC=C(C)C)C[C@H]1C(C)=CC[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C29H52N2/c1-23(2)14-19-30-18-9-10-20-31(21-15-24(3)4)22-26-25(5)12-13-27-28(6,7)16-11-17-29(26,27)8/h12,14-15,26-27,30H,9-11,13,16-22H2,1-8H3/t26-,27-,29+/m0/s1 |
| InChIKey | XCLQLVOVBWDWOP-HPUNYJORSA-N |
| XLogP | 7.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|