C25H21Cl3N4O — CID 56834762
4-(2-chlorophenyl)-8-(2,6-dichlorophenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine (PubChem CID 56834762) has the molecular formula C25H21Cl3N4O and a molecular weight of 499.83 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-8-(2,6-dichlorophenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine.
| Compound Name | 4-(2-chlorophenyl)-8-(2,6-dichlorophenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine |
|---|---|
| PubChem CID | 56834762 |
| Molecular Formula | C25H21Cl3N4O |
| Molecular Weight | 499.83 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 4-(2-chlorophenyl)-8-(2,6-dichlorophenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine |
| SMILES | [O-][n+]1ccc2c(-c3ccccc3Cl)cc(NC3CCNCC3)nc2c1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H21Cl3N4O/c26-19-5-2-1-4-16(19)18-14-22(30-15-8-11-29-12-9-15)31-24-17(18)10-13-32(33)25(24)23-20(27)6-3-7-21(23)28/h1-7,10,13-15,29H,8-9,11-12H2,(H,30,31) |
| InChIKey | QAVTVQSLMNNQQE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 63.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.83 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|