C30H31Cl3N4O — CID 56834763
4-(2-chlorophenyl)-8-(2,6-dichlorophenyl)-7-oxido-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,7-naphthyridin-7-ium-2-amine (PubChem CID 56834763) has the molecular formula C30H31Cl3N4O and a molecular weight of 569.96 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-8-(2,6-dichlorophenyl)-7-oxido-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,7-naphthyridin-7-ium-2-amine.
| Compound Name | 4-(2-chlorophenyl)-8-(2,6-dichlorophenyl)-7-oxido-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,7-naphthyridin-7-ium-2-amine |
|---|---|
| PubChem CID | 56834763 |
| Molecular Formula | C30H31Cl3N4O |
| Molecular Weight | 569.96 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 4-(2-chlorophenyl)-8-(2,6-dichlorophenyl)-7-oxido-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,7-naphthyridin-7-ium-2-amine |
| SMILES | CN1C(C)(C)CC(Nc2cc(-c3ccccc3Cl)c3cc[n+]([O-])c(-c4c(Cl)cccc4Cl)c3n2)CC1(C)C |
| InChI | InChI=1S/C30H31Cl3N4O/c1-29(2)16-18(17-30(3,4)36(29)5)34-25-15-21(19-9-6-7-10-22(19)31)20-13-14-37(38)28(27(20)35-25)26-23(32)11-8-12-24(26)33/h6-15,18H,16-17H2,1-5H3,(H,34,35) |
| InChIKey | WOXFIIIHPWKJPG-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.96 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|