C19H5BrF9NO — CID 56834786
[2-(4-bromoanilino)-3,4,5,6-tetrafluorophenyl]-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 56834786) has the molecular formula C19H5BrF9NO and a molecular weight of 514.14 g/mol. Its IUPAC name is [2-(4-bromoanilino)-3,4,5,6-tetrafluorophenyl]-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | [2-(4-bromoanilino)-3,4,5,6-tetrafluorophenyl]-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 56834786 |
| Molecular Formula | C19H5BrF9NO |
| Molecular Weight | 514.14 g/mol |
| Exact Mass | 512.94 |
| IUPAC Name | [2-(4-bromoanilino)-3,4,5,6-tetrafluorophenyl]-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H5BrF9NO/c20-5-1-3-6(4-2-5)30-18-8(11(23)14(26)16(28)17(18)29)19(31)7-9(21)12(24)15(27)13(25)10(7)22/h1-4,30H |
| InChIKey | UEJSQGYNUFIRKY-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.14 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|