C20H9ClF4N2O — CID 56834855
2-chloro-4-(2,4-difluorophenyl)-8-(2,6-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium (PubChem CID 56834855) has the molecular formula C20H9ClF4N2O and a molecular weight of 404.75 g/mol. Its IUPAC name is 2-chloro-4-(2,4-difluorophenyl)-8-(2,6-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium.
| Compound Name | 2-chloro-4-(2,4-difluorophenyl)-8-(2,6-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium |
|---|---|
| PubChem CID | 56834855 |
| Molecular Formula | C20H9ClF4N2O |
| Molecular Weight | 404.75 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 2-chloro-4-(2,4-difluorophenyl)-8-(2,6-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium |
| SMILES | [O-][n+]1ccc2c(-c3ccc(F)cc3F)cc(Cl)nc2c1-c1c(F)cccc1F |
| InChI | InChI=1S/C20H9ClF4N2O/c21-17-9-13(11-5-4-10(22)8-16(11)25)12-6-7-27(28)20(19(12)26-17)18-14(23)2-1-3-15(18)24/h1-9H |
| InChIKey | NOOPKWKNHLNQHG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 39.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.75 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|