About methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate
methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate (PubChem CID 56834894) has the molecular formula C16H30O5
and a molecular weight of 302.41 g/mol. Its IUPAC name is methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate.
Molecular Properties
| Compound Name | methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate |
| PubChem CID | 56834894 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate |
| SMILES | CCCCC1(CCCC)C[C@H](C(=O)OC)[C@@](C)(OC)OO1 |
| InChI | InChI=1S/C16H30O5/c1-6-8-10-16(11-9-7-2)12-13(14(17)18-4)15(3,19-5)20-21-16/h13H,6-12H2,1-5H3/t13-,15+/m1/s1 |
| InChIKey | DDUNIFXXKUGGLJ-HIFRSBDPSA-N |
| XLogP | 3.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate?
The IUPAC name of methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate (CID 56834894) is methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate.
What is the SMILES notation for methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate?
The canonical SMILES for methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate is CCCCC1(CCCC)C[C@H](C(=O)OC)[C@@](C)(OC)OO1.
What is the InChIKey of methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate?
The InChIKey is DDUNIFXXKUGGLJ-HIFRSBDPSA-N. The full InChI is InChI=1S/C16H30O5/c1-6-8-10-16(11-9-7-2)12-13(14(17)18-4)15(3,19-5)20-21-16/h13H,6-12H2,1-5H3/t13-,15+/m1/s1.
What are the key properties of methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate?
methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate has a molecular weight of 302.41 g/mol, XLogP of 3.61, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxane-4-carboxylate is sourced from PubChem (CID 56834894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).