C32H32N4O2 — CID 56835067
16-[2-(diethylamino)ethyl]-5-piperazin-1-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione (PubChem CID 56835067) has the molecular formula C32H32N4O2 and a molecular weight of 504.63 g/mol. Its IUPAC name is 16-[2-(diethylamino)ethyl]-5-piperazin-1-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione.
| Compound Name | 16-[2-(diethylamino)ethyl]-5-piperazin-1-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
|---|---|
| PubChem CID | 56835067 |
| Molecular Formula | C32H32N4O2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 16-[2-(diethylamino)ethyl]-5-piperazin-1-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
| SMILES | CCN(CC)CCN1C(=O)c2ccc3c4cccc5c(N6CCNCC6)ccc(c6ccc(c2c36)C1=O)c54 |
| InChI | InChI=1S/C32H32N4O2/c1-3-34(4-2)18-19-36-31(37)25-10-8-22-20-6-5-7-24-27(35-16-14-33-15-17-35)13-12-21(28(20)24)23-9-11-26(32(36)38)30(25)29(22)23/h5-13,33H,3-4,14-19H2,1-2H3 |
| InChIKey | NDJVSFSFJHWFPQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|