About 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea
1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea (PubChem CID 56835091) has the molecular formula C17H14F6N2O2
and a molecular weight of 392.30 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea |
| PubChem CID | 56835091 |
| Molecular Formula | C17H14F6N2O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1C |
| InChI | InChI=1S/C17H14F6N2O2/c1-9-3-4-12(8-14(9)27-2)24-15(26)25-13-6-10(16(18,19)20)5-11(7-13)17(21,22)23/h3-8H,1-2H3,(H2,24,25,26) |
| InChIKey | SRVJTESJTQUVOU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea (CID 56835091) is 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea is COc1cc(NC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1C.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea?
The InChIKey is SRVJTESJTQUVOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F6N2O2/c1-9-3-4-12(8-14(9)27-2)24-15(26)25-13-6-10(16(18,19)20)5-11(7-13)17(21,22)23/h3-8H,1-2H3,(H2,24,25,26).
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea?
1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea has a molecular weight of 392.30 g/mol, XLogP of 5.69, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methoxy-4-methylphenyl)urea is sourced from PubChem (CID 56835091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).