About (1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol
(1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol (PubChem CID 56835179) has the molecular formula C17H17N3O
and a molecular weight of 279.34 g/mol. Its IUPAC name is (1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol.
Molecular Properties
| Compound Name | (1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol |
| PubChem CID | 56835179 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol |
| SMILES | O[C@H](c1ccccc1)[C@@H](Cn1ccnn1)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O/c21-17(15-9-5-2-6-10-15)16(13-20-12-11-18-19-20)14-7-3-1-4-8-14/h1-12,16-17,21H,13H2/t16-,17+/m0/s1 |
| InChIKey | AOUFLDFQEMUYCL-DLBZAZTESA-N |
| XLogP | 2.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol?
The IUPAC name of (1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol (CID 56835179) is (1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol.
What is the SMILES notation for (1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol?
The canonical SMILES for (1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol is O[C@H](c1ccccc1)[C@@H](Cn1ccnn1)c1ccccc1.
What is the InChIKey of (1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol?
The InChIKey is AOUFLDFQEMUYCL-DLBZAZTESA-N. The full InChI is InChI=1S/C17H17N3O/c21-17(15-9-5-2-6-10-15)16(13-20-12-11-18-19-20)14-7-3-1-4-8-14/h1-12,16-17,21H,13H2/t16-,17+/m0/s1.
What are the key properties of (1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol?
(1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol has a molecular weight of 279.34 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-1,2-diphenyl-3-(triazol-1-yl)propan-1-ol is sourced from PubChem (CID 56835179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).