C20H27FN4O — CID 56835761
6-{[(3s,4s)-4-{2-[(2-Fluorobenzyl)amino]ethoxy}pyrrolidin-3-Yl]methyl}-4-Methylpyridin-2-Amine (PubChem CID 56835761) has the molecular formula C20H27FN4O and a molecular weight of 358.50 g/mol. Its IUPAC name is 6-[[(3S,4S)-4-[2-[(2-fluorophenyl)methylamino]ethoxy]pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine.
| Compound Name | 6-{[(3s,4s)-4-{2-[(2-Fluorobenzyl)amino]ethoxy}pyrrolidin-3-Yl]methyl}-4-Methylpyridin-2-Amine |
|---|---|
| PubChem CID | 56835761 |
| Molecular Formula | C20H27FN4O |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 6-[[(3S,4S)-4-[2-[(2-fluorophenyl)methylamino]ethoxy]pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine |
| SMILES | CC1=CC(=NC(=C1)N)C[C@H]2CNC[C@H]2OCCNCC3=CC=CC=C3F |
| InChI | InChI=1S/C20H27FN4O/c1-14-8-17(25-20(22)9-14)10-16-12-24-13-19(16)26-7-6-23-11-15-4-2-3-5-18(15)21/h2-5,8-9,16,19,23-24H,6-7,10-13H2,1H3,(H2,22,25)/t16-,19+/m0/s1 |
| InChIKey | PMZVISPCVPVOFN-QFBILLFUSA-N |
| XLogP | 1.80 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | 413 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|