About N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide
N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide (PubChem CID 56835860) has the molecular formula C20H23N5O
and a molecular weight of 349.44 g/mol. Its IUPAC name is N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide |
| PubChem CID | 56835860 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide |
| SMILES | Cc1cc(N)nc(C)c1CNC(=O)c1cnn(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C20H23N5O/c1-13-9-19(21)24-14(2)18(13)11-22-20(26)17-10-23-25(12-17)15(3)16-7-5-4-6-8-16/h4-10,12,15H,11H2,1-3H3,(H2,21,24)(H,22,26) |
| InChIKey | DTLRUZKFZYHOBO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide?
The IUPAC name of N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide (CID 56835860) is N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide.
What is the SMILES notation for N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide?
The canonical SMILES for N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide is Cc1cc(N)nc(C)c1CNC(=O)c1cnn(C(C)c2ccccc2)c1.
What is the InChIKey of N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide?
The InChIKey is DTLRUZKFZYHOBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N5O/c1-13-9-19(21)24-14(2)18(13)11-22-20(26)17-10-23-25(12-17)15(3)16-7-5-4-6-8-16/h4-10,12,15H,11H2,1-3H3,(H2,21,24)(H,22,26).
What are the key properties of N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide?
N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide has a molecular weight of 349.44 g/mol, XLogP of 3.02, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-(1-phenylethyl)pyrazole-4-carboxamide is sourced from PubChem (CID 56835860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).