C27H28N4O8 — CID 56835939
methyl 4-[[3-[2-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-oxoacetyl]-1H-indol-7-yl]amino]-2,3-dihydroxy-4-oxobutanoate (PubChem CID 56835939) has the molecular formula C27H28N4O8 and a molecular weight of 536.54 g/mol. Its IUPAC name is methyl 4-[[3-[2-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-oxoacetyl]-1H-indol-7-yl]amino]-2,3-dihydroxy-4-oxobutanoate.
| Compound Name | methyl 4-[[3-[2-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-oxoacetyl]-1H-indol-7-yl]amino]-2,3-dihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 56835939 |
| Molecular Formula | C27H28N4O8 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | methyl 4-[[3-[2-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-oxoacetyl]-1H-indol-7-yl]amino]-2,3-dihydroxy-4-oxobutanoate |
| SMILES | COC(=O)C(O)C(O)C(=O)Nc1cccc2c(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)C[C@H]3C)c[nH]c12 |
| InChI | InChI=1S/C27H28N4O8/c1-15-14-30(25(36)16-7-4-3-5-8-16)11-12-31(15)26(37)21(32)18-13-28-20-17(18)9-6-10-19(20)29-24(35)22(33)23(34)27(38)39-2/h3-10,13,15,22-23,28,33-34H,11-12,14H2,1-2H3,(H,29,35)/t15-,22?,23?/m1/s1 |
| InChIKey | LWQMSAUOLYVYCF-CGDGTSQQSA-N |
| XLogP | 0.56 |
| TPSA | 169.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|