C24H27F3N4O3S — CID 56835967
N-[2-[3-[3-benzyl-1-(2,2,2-trifluoroethyl)azetidin-3-yl]phenoxy]ethyl]-1-methylimidazole-4-sulfonamide (PubChem CID 56835967) has the molecular formula C24H27F3N4O3S and a molecular weight of 508.57 g/mol. Its IUPAC name is N-[2-[3-[3-benzyl-1-(2,2,2-trifluoroethyl)azetidin-3-yl]phenoxy]ethyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[2-[3-[3-benzyl-1-(2,2,2-trifluoroethyl)azetidin-3-yl]phenoxy]ethyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 56835967 |
| Molecular Formula | C24H27F3N4O3S |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | N-[2-[3-[3-benzyl-1-(2,2,2-trifluoroethyl)azetidin-3-yl]phenoxy]ethyl]-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCCOc2cccc(C3(Cc4ccccc4)CN(CC(F)(F)F)C3)c2)c1 |
| InChI | InChI=1S/C24H27F3N4O3S/c1-30-14-22(28-18-30)35(32,33)29-10-11-34-21-9-5-8-20(12-21)23(13-19-6-3-2-4-7-19)15-31(16-23)17-24(25,26)27/h2-9,12,14,18,29H,10-11,13,15-17H2,1H3 |
| InChIKey | YCWLCZRTIDHAIQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|