C23H28N4O3S — CID 56836034
N-[2-[3-(3-benzylpyrrolidin-3-yl)phenoxy]ethyl]-1-methylpyrazole-4-sulfonamide (PubChem CID 56836034) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[2-[3-(3-benzylpyrrolidin-3-yl)phenoxy]ethyl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-[2-[3-(3-benzylpyrrolidin-3-yl)phenoxy]ethyl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 56836034 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-[2-[3-(3-benzylpyrrolidin-3-yl)phenoxy]ethyl]-1-methylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCCOc2cccc(C3(Cc4ccccc4)CCNC3)c2)cn1 |
| InChI | InChI=1S/C23H28N4O3S/c1-27-17-22(16-25-27)31(28,29)26-12-13-30-21-9-5-8-20(14-21)23(10-11-24-18-23)15-19-6-3-2-4-7-19/h2-9,14,16-17,24,26H,10-13,15,18H2,1H3 |
| InChIKey | CFTHJDDWWCKSQB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|