C34H29N5O7 — CID 56836215
dimethyl 5-[[3-[2-[4-[cyano(phenyl)methylidene]piperidin-1-yl]-2-oxoacetyl]-1H-indol-7-yl]carbamoylamino]benzene-1,3-dicarboxylate (PubChem CID 56836215) has the molecular formula C34H29N5O7 and a molecular weight of 619.63 g/mol. Its IUPAC name is dimethyl 5-[[3-[2-[4-[cyano(phenyl)methylidene]piperidin-1-yl]-2-oxoacetyl]-1H-indol-7-yl]carbamoylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[3-[2-[4-[cyano(phenyl)methylidene]piperidin-1-yl]-2-oxoacetyl]-1H-indol-7-yl]carbamoylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 56836215 |
| Molecular Formula | C34H29N5O7 |
| Molecular Weight | 619.63 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | dimethyl 5-[[3-[2-[4-[cyano(phenyl)methylidene]piperidin-1-yl]-2-oxoacetyl]-1H-indol-7-yl]carbamoylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)Nc2cccc3c(C(=O)C(=O)N4CCC(=C(C#N)c5ccccc5)CC4)c[nH]c23)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C34H29N5O7/c1-45-32(42)22-15-23(33(43)46-2)17-24(16-22)37-34(44)38-28-10-6-9-25-27(19-36-29(25)28)30(40)31(41)39-13-11-21(12-14-39)26(18-35)20-7-4-3-5-8-20/h3-10,15-17,19,36H,11-14H2,1-2H3,(H2,37,38,44) |
| InChIKey | GIBLYVQLZLUWKT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 170.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|