C22H21ClN6O2S — CID 56836219
1-[(4-chlorophenyl)methyl]-N',N'-dimethyl-2-[(2-methyl-1,3-benzothiazol-6-yl)amino]-4-oxopyrimidine-5-carbohydrazide (PubChem CID 56836219) has the molecular formula C22H21ClN6O2S and a molecular weight of 468.97 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N',N'-dimethyl-2-[(2-methyl-1,3-benzothiazol-6-yl)amino]-4-oxopyrimidine-5-carbohydrazide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N',N'-dimethyl-2-[(2-methyl-1,3-benzothiazol-6-yl)amino]-4-oxopyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 56836219 |
| Molecular Formula | C22H21ClN6O2S |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N',N'-dimethyl-2-[(2-methyl-1,3-benzothiazol-6-yl)amino]-4-oxopyrimidine-5-carbohydrazide |
| SMILES | Cc1nc2ccc(Nc3nc(=O)c(C(=O)NN(C)C)cn3Cc3ccc(Cl)cc3)cc2s1 |
| InChI | InChI=1S/C22H21ClN6O2S/c1-13-24-18-9-8-16(10-19(18)32-13)25-22-26-20(30)17(21(31)27-28(2)3)12-29(22)11-14-4-6-15(23)7-5-14/h4-10,12H,11H2,1-3H3,(H,27,31)(H,25,26,30) |
| InChIKey | FYBAFVXPBQQWHD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|