About methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate
methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate (PubChem CID 56836385) has the molecular formula C19H22N4O2S2
and a molecular weight of 402.55 g/mol. Its IUPAC name is methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate.
Molecular Properties
| Compound Name | methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate |
| PubChem CID | 56836385 |
| Molecular Formula | C19H22N4O2S2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C(/N)SCCCS/C(N)=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22N4O2S2/c1-25-17(24)14-8-10-16(11-9-14)23-19(21)27-13-5-12-26-18(20)22-15-6-3-2-4-7-15/h2-4,6-11H,5,12-13H2,1H3,(H2,20,22)(H2,21,23) |
| InChIKey | SIYNVHHONGDJBY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate?
The IUPAC name of methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate (CID 56836385) is methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate.
What is the SMILES notation for methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate?
The canonical SMILES for methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate is COC(=O)c1ccc(/N=C(/N)SCCCS/C(N)=N/c2ccccc2)cc1.
What is the InChIKey of methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate?
The InChIKey is SIYNVHHONGDJBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O2S2/c1-25-17(24)14-8-10-16(11-9-14)23-19(21)27-13-5-12-26-18(20)22-15-6-3-2-4-7-15/h2-4,6-11H,5,12-13H2,1H3,(H2,20,22)(H2,21,23).
What are the key properties of methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate?
methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate has a molecular weight of 402.55 g/mol, XLogP of 3.92, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[amino-[3-(N'-phenylcarbamimidoyl)sulfanylpropylsulfanyl]methylidene]amino]benzoate is sourced from PubChem (CID 56836385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).