C18H19F4N7OS — CID 56836649
5-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-N-[4-(2-fluoroethoxyimino)cyclohexyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 56836649) has the molecular formula C18H19F4N7OS and a molecular weight of 457.46 g/mol. Its IUPAC name is 5-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-N-[4-(2-fluoroethoxyimino)cyclohexyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | 5-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-N-[4-(2-fluoroethoxyimino)cyclohexyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 56836649 |
| Molecular Formula | C18H19F4N7OS |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 5-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-N-[4-(2-fluoroethoxyimino)cyclohexyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | Nc1ncc(-c2cnc3sc(NC4CCC(=NOCCF)CC4)nn23)cc1C(F)(F)F |
| InChI | InChI=1S/C18H19F4N7OS/c19-5-6-30-28-12-3-1-11(2-4-12)26-16-27-29-14(9-25-17(29)31-16)10-7-13(18(20,21)22)15(23)24-8-10/h7-9,11H,1-6H2,(H2,23,24)(H,26,27)/b28-12- |
| InChIKey | DHDYZXPVISKUIP-NVJOKUIPSA-N |
| XLogP | 4.15 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|