C24H34N2O5 — CID 56836722
2,3-dimethoxy-5-methyl-6-[10-(6-methylpyrimidin-4-yl)oxydecyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 56836722) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[10-(6-methylpyrimidin-4-yl)oxydecyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[10-(6-methylpyrimidin-4-yl)oxydecyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 56836722 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[10-(6-methylpyrimidin-4-yl)oxydecyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCCOc2cc(C)ncn2)=C(C)C1=O |
| InChI | InChI=1S/C24H34N2O5/c1-17-15-20(26-16-25-17)31-14-12-10-8-6-5-7-9-11-13-19-18(2)21(27)23(29-3)24(30-4)22(19)28/h15-16H,5-14H2,1-4H3 |
| InChIKey | BWRQIPRGCBIEJQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|